C8H18N4O2 — CID 138640636
1-[(2S)-1-(carbamoylamino)-3-methylbutan-2-yl]-3-methylurea (PubChem CID 138640636) has the molecular formula C8H18N4O2 and a molecular weight of 202.26 g/mol. Its IUPAC name is 1-[(2S)-1-(carbamoylamino)-3-methylbutan-2-yl]-3-methylurea.
| Compound Name | 1-[(2S)-1-(carbamoylamino)-3-methylbutan-2-yl]-3-methylurea |
|---|---|
| PubChem CID | 138640636 |
| Molecular Formula | C8H18N4O2 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 1-[(2S)-1-(carbamoylamino)-3-methylbutan-2-yl]-3-methylurea |
| SMILES | CNC(=O)N[C@H](CNC(N)=O)C(C)C |
| InChI | InChI=1S/C8H18N4O2/c1-5(2)6(4-11-7(9)13)12-8(14)10-3/h5-6H,4H2,1-3H3,(H3,9,11,13)(H2,10,12,14)/t6-/m1/s1 |
| InChIKey | ZLZVBZGBUJWIHX-ZCFIWIBFSA-N |
| XLogP | -0.39 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |