C4H10N2O3 — CID 88558789
[(2R)-2,3-dihydroxypropyl]urea (PubChem CID 88558789) has the molecular formula C4H10N2O3 and a molecular weight of 134.14 g/mol. Its IUPAC name is [(2R)-2,3-dihydroxypropyl]urea.
| Compound Name | [(2R)-2,3-dihydroxypropyl]urea |
|---|---|
| PubChem CID | 88558789 |
| Molecular Formula | C4H10N2O3 |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | [(2R)-2,3-dihydroxypropyl]urea |
| SMILES | NC(=O)NC[C@@H](O)CO |
| InChI | InChI=1S/C4H10N2O3/c5-4(9)6-1-3(8)2-7/h3,7-8H,1-2H2,(H3,5,6,9)/t3-/m1/s1 |
| InChIKey | IWJFGRNIFIABLP-GSVOUGTGSA-N |
| XLogP | -1.99 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |