C6H13NO3 — CID 88953699
N-[(2R)-2,3-dihydroxypropyl]propanamide (PubChem CID 88953699) has the molecular formula C6H13NO3 and a molecular weight of 147.17 g/mol. Its IUPAC name is N-[(2R)-2,3-dihydroxypropyl]propanamide.
| Compound Name | N-[(2R)-2,3-dihydroxypropyl]propanamide |
|---|---|
| PubChem CID | 88953699 |
| Molecular Formula | C6H13NO3 |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | N-[(2R)-2,3-dihydroxypropyl]propanamide |
| SMILES | CCC(=O)NC[C@@H](O)CO |
| InChI | InChI=1S/C6H13NO3/c1-2-6(10)7-3-5(9)4-8/h5,8-9H,2-4H2,1H3,(H,7,10)/t5-/m1/s1 |
| InChIKey | QJOQSNARVCFLIV-RXMQYKEDSA-N |
| XLogP | -1.13 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |