About N-(2,3-dihydroxypropyl)-4-(methylamino)butanamide
N-(2,3-dihydroxypropyl)-4-(methylamino)butanamide (PubChem CID 66168913) has the molecular formula C8H18N2O3
and a molecular weight of 190.24 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-4-(methylamino)butanamide.
Molecular Properties
| Compound Name | N-(2,3-dihydroxypropyl)-4-(methylamino)butanamide |
| PubChem CID | 66168913 |
| Molecular Formula | C8H18N2O3 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-4-(methylamino)butanamide |
| SMILES | CNCCCC(=O)NCC(O)CO |
| InChI | InChI=1S/C8H18N2O3/c1-9-4-2-3-8(13)10-5-7(12)6-11/h7,9,11-12H,2-6H2,1H3,(H,10,13) |
| InChIKey | BPCABSBYTYCONS-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2,3-dihydroxypropyl)-4-(methylamino)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dihydroxypropyl)-4-(methylamino)butanamide?
The IUPAC name of N-(2,3-dihydroxypropyl)-4-(methylamino)butanamide (CID 66168913) is N-(2,3-dihydroxypropyl)-4-(methylamino)butanamide.
What is the SMILES notation for N-(2,3-dihydroxypropyl)-4-(methylamino)butanamide?
The canonical SMILES for N-(2,3-dihydroxypropyl)-4-(methylamino)butanamide is CNCCCC(=O)NCC(O)CO.
What is the InChIKey of N-(2,3-dihydroxypropyl)-4-(methylamino)butanamide?
The InChIKey is BPCABSBYTYCONS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O3/c1-9-4-2-3-8(13)10-5-7(12)6-11/h7,9,11-12H,2-6H2,1H3,(H,10,13).
What are the key properties of N-(2,3-dihydroxypropyl)-4-(methylamino)butanamide?
N-(2,3-dihydroxypropyl)-4-(methylamino)butanamide has a molecular weight of 190.24 g/mol, XLogP of -1.54, 7 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dihydroxypropyl)-4-(methylamino)butanamide is sourced from PubChem (CID 66168913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).