C11H24ClN3O2 — CID 119687959
4-(methylamino)-N-[2-(2-methylpropanoylamino)ethyl]butanamide;hydrochloride (PubChem CID 119687959) has the molecular formula C11H24ClN3O2 and a molecular weight of 265.78 g/mol. Its IUPAC name is 4-(methylamino)-N-[2-(2-methylpropanoylamino)ethyl]butanamide;hydrochloride.
| Compound Name | 4-(methylamino)-N-[2-(2-methylpropanoylamino)ethyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119687959 |
| Molecular Formula | C11H24ClN3O2 |
| Molecular Weight | 265.78 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 4-(methylamino)-N-[2-(2-methylpropanoylamino)ethyl]butanamide;hydrochloride |
| SMILES | CNCCCC(=O)NCCNC(=O)C(C)C.Cl |
| InChI | InChI=1S/C11H23N3O2.ClH/c1-9(2)11(16)14-8-7-13-10(15)5-4-6-12-3;/h9,12H,4-8H2,1-3H3,(H,13,15)(H,14,16);1H |
| InChIKey | SRZAZYIKRUXEKA-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.78 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|