C10H20N2O3Y — CID 59926153
4-[5-(methylamino)pentylamino]-4-oxobutanoic acid;yttrium (PubChem CID 59926153) has the molecular formula C10H20N2O3Y and a molecular weight of 305.19 g/mol. Its IUPAC name is 4-[5-(methylamino)pentylamino]-4-oxobutanoic acid;yttrium.
| Compound Name | 4-[5-(methylamino)pentylamino]-4-oxobutanoic acid;yttrium |
|---|---|
| PubChem CID | 59926153 |
| Molecular Formula | C10H20N2O3Y |
| Molecular Weight | 305.19 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 4-[5-(methylamino)pentylamino]-4-oxobutanoic acid;yttrium |
| SMILES | CNCCCCCNC(=O)CCC(=O)O.[Y] |
| InChI | InChI=1S/C10H20N2O3.Y/c1-11-7-3-2-4-8-12-9(13)5-6-10(14)15;/h11H,2-8H2,1H3,(H,12,13)(H,14,15); |
| InChIKey | ITJIPDFRSVCYOE-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.19 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|