C13H18Cl2N2O2 — CID 119792581
N-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-4-(methylamino)butanamide (PubChem CID 119792581) has the molecular formula C13H18Cl2N2O2 and a molecular weight of 305.21 g/mol. Its IUPAC name is N-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-4-(methylamino)butanamide.
| Compound Name | N-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-4-(methylamino)butanamide |
|---|---|
| PubChem CID | 119792581 |
| Molecular Formula | C13H18Cl2N2O2 |
| Molecular Weight | 305.21 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | N-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-4-(methylamino)butanamide |
| SMILES | CNCCCC(=O)NCC(O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H18Cl2N2O2/c1-16-4-2-3-13(19)17-8-12(18)9-5-10(14)7-11(15)6-9/h5-7,12,16,18H,2-4,8H2,1H3,(H,17,19) |
| InChIKey | KMBMEZZVPSFBIW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.21 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|