C14H17Cl2NO3 — CID 95771596
(2S)-N-[(2R)-2-(3,5-dichlorophenyl)-2-hydroxyethyl]-2-prop-2-enoxypropanamide (PubChem CID 95771596) has the molecular formula C14H17Cl2NO3 and a molecular weight of 318.20 g/mol. Its IUPAC name is (2S)-N-[(2R)-2-(3,5-dichlorophenyl)-2-hydroxyethyl]-2-prop-2-enoxypropanamide.
| Compound Name | (2S)-N-[(2R)-2-(3,5-dichlorophenyl)-2-hydroxyethyl]-2-prop-2-enoxypropanamide |
|---|---|
| PubChem CID | 95771596 |
| Molecular Formula | C14H17Cl2NO3 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | (2S)-N-[(2R)-2-(3,5-dichlorophenyl)-2-hydroxyethyl]-2-prop-2-enoxypropanamide |
| SMILES | C=CCO[C@@H](C)C(=O)NC[C@H](O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H17Cl2NO3/c1-3-4-20-9(2)14(19)17-8-13(18)10-5-11(15)7-12(16)6-10/h3,5-7,9,13,18H,1,4,8H2,2H3,(H,17,19)/t9-,13-/m0/s1 |
| InChIKey | JDPPXXDYVZJHNJ-ZANVPECISA-N |
| XLogP | 2.73 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|