C15H19F2NO3 — CID 111451404
2-but-3-enoxy-N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]propanamide (PubChem CID 111451404) has the molecular formula C15H19F2NO3 and a molecular weight of 299.32 g/mol. Its IUPAC name is 2-but-3-enoxy-N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]propanamide.
| Compound Name | 2-but-3-enoxy-N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]propanamide |
|---|---|
| PubChem CID | 111451404 |
| Molecular Formula | C15H19F2NO3 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-but-3-enoxy-N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]propanamide |
| SMILES | C=CCCOC(C)C(=O)NCC(O)c1c(F)cccc1F |
| InChI | InChI=1S/C15H19F2NO3/c1-3-4-8-21-10(2)15(20)18-9-13(19)14-11(16)6-5-7-12(14)17/h3,5-7,10,13,19H,1,4,8-9H2,2H3,(H,18,20) |
| InChIKey | DOTMOJCNJRQVFX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|