C17H18F2N2O2 — CID 111452505
1-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-3-(2,5-dimethylphenyl)urea (PubChem CID 111452505) has the molecular formula C17H18F2N2O2 and a molecular weight of 320.34 g/mol. Its IUPAC name is 1-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-3-(2,5-dimethylphenyl)urea.
| Compound Name | 1-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-3-(2,5-dimethylphenyl)urea |
|---|---|
| PubChem CID | 111452505 |
| Molecular Formula | C17H18F2N2O2 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 1-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-3-(2,5-dimethylphenyl)urea |
| SMILES | Cc1ccc(C)c(NC(=O)NCC(O)c2c(F)cccc2F)c1 |
| InChI | InChI=1S/C17H18F2N2O2/c1-10-6-7-11(2)14(8-10)21-17(23)20-9-15(22)16-12(18)4-3-5-13(16)19/h3-8,15,22H,9H2,1-2H3,(H2,20,21,23) |
| InChIKey | ZRTLUCULXCYLFO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |