C17H19ClN2O2 — CID 51943967
1-[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]-3-(2,5-dimethylphenyl)urea (PubChem CID 51943967) has the molecular formula C17H19ClN2O2 and a molecular weight of 318.80 g/mol. Its IUPAC name is 1-[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]-3-(2,5-dimethylphenyl)urea.
| Compound Name | 1-[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]-3-(2,5-dimethylphenyl)urea |
|---|---|
| PubChem CID | 51943967 |
| Molecular Formula | C17H19ClN2O2 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 1-[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]-3-(2,5-dimethylphenyl)urea |
| SMILES | Cc1ccc(C)c(NC(=O)NC[C@H](O)c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C17H19ClN2O2/c1-11-6-7-12(2)15(8-11)20-17(22)19-10-16(21)13-4-3-5-14(18)9-13/h3-9,16,21H,10H2,1-2H3,(H2,19,20,22)/t16-/m0/s1 |
| InChIKey | UUSNHKVDMNCTMU-INIZCTEOSA-N |
| XLogP | 3.81 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |