C15H13Cl3N2O2 — CID 51944288
1-[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]-3-(2,4-dichlorophenyl)urea (PubChem CID 51944288) has the molecular formula C15H13Cl3N2O2 and a molecular weight of 359.64 g/mol. Its IUPAC name is 1-[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]-3-(2,4-dichlorophenyl)urea.
| Compound Name | 1-[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]-3-(2,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 51944288 |
| Molecular Formula | C15H13Cl3N2O2 |
| Molecular Weight | 359.64 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | 1-[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]-3-(2,4-dichlorophenyl)urea |
| SMILES | O=C(NC[C@H](O)c1cccc(Cl)c1)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H13Cl3N2O2/c16-10-3-1-2-9(6-10)14(21)8-19-15(22)20-13-5-4-11(17)7-12(13)18/h1-7,14,21H,8H2,(H2,19,20,22)/t14-/m0/s1 |
| InChIKey | DIWFUTYSTWJGPN-AWEZNQCLSA-N |
| XLogP | 4.50 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.64 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |