C16H13Cl2N3O2 — CID 51945011
1-(3-chloro-4-cyanophenyl)-3-[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]urea (PubChem CID 51945011) has the molecular formula C16H13Cl2N3O2 and a molecular weight of 350.21 g/mol. Its IUPAC name is 1-(3-chloro-4-cyanophenyl)-3-[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]urea.
| Compound Name | 1-(3-chloro-4-cyanophenyl)-3-[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]urea |
|---|---|
| PubChem CID | 51945011 |
| Molecular Formula | C16H13Cl2N3O2 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 1-(3-chloro-4-cyanophenyl)-3-[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]urea |
| SMILES | N#Cc1ccc(NC(=O)NC[C@@H](O)c2cccc(Cl)c2)cc1Cl |
| InChI | InChI=1S/C16H13Cl2N3O2/c17-12-3-1-2-10(6-12)15(22)9-20-16(23)21-13-5-4-11(8-19)14(18)7-13/h1-7,15,22H,9H2,(H2,20,21,23)/t15-/m1/s1 |
| InChIKey | NSMRAYMDXPOKJL-OAHLLOKOSA-N |
| XLogP | 3.72 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |