C15H20ClN3O2 — CID 111473269
1-(3-chloro-4-cyanophenyl)-3-(4-hydroxy-2,2-dimethylpentyl)urea (PubChem CID 111473269) has the molecular formula C15H20ClN3O2 and a molecular weight of 309.80 g/mol. Its IUPAC name is 1-(3-chloro-4-cyanophenyl)-3-(4-hydroxy-2,2-dimethylpentyl)urea.
| Compound Name | 1-(3-chloro-4-cyanophenyl)-3-(4-hydroxy-2,2-dimethylpentyl)urea |
|---|---|
| PubChem CID | 111473269 |
| Molecular Formula | C15H20ClN3O2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 1-(3-chloro-4-cyanophenyl)-3-(4-hydroxy-2,2-dimethylpentyl)urea |
| SMILES | CC(O)CC(C)(C)CNC(=O)Nc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C15H20ClN3O2/c1-10(20)7-15(2,3)9-18-14(21)19-12-5-4-11(8-17)13(16)6-12/h4-6,10,20H,7,9H2,1-3H3,(H2,18,19,21) |
| InChIKey | UTMXYADHFAABSI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |