C14H18ClN3O — CID 65264787
3-amino-N-(3-chloro-4-cyanophenyl)-2,2,3-trimethylbutanamide (PubChem CID 65264787) has the molecular formula C14H18ClN3O and a molecular weight of 279.77 g/mol. Its IUPAC name is 3-amino-N-(3-chloro-4-cyanophenyl)-2,2,3-trimethylbutanamide.
| Compound Name | 3-amino-N-(3-chloro-4-cyanophenyl)-2,2,3-trimethylbutanamide |
|---|---|
| PubChem CID | 65264787 |
| Molecular Formula | C14H18ClN3O |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 3-amino-N-(3-chloro-4-cyanophenyl)-2,2,3-trimethylbutanamide |
| SMILES | CC(C)(N)C(C)(C)C(=O)Nc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C14H18ClN3O/c1-13(2,14(3,4)17)12(19)18-10-6-5-9(8-16)11(15)7-10/h5-7H,17H2,1-4H3,(H,18,19) |
| InChIKey | MMUYXPFYZRHETP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |