C16H20ClN3O — CID 83199456
N-(3-chloro-4-cyanophenyl)-2-methyl-2-piperidin-3-ylpropanamide (PubChem CID 83199456) has the molecular formula C16H20ClN3O and a molecular weight of 305.81 g/mol. Its IUPAC name is N-(3-chloro-4-cyanophenyl)-2-methyl-2-piperidin-3-ylpropanamide.
| Compound Name | N-(3-chloro-4-cyanophenyl)-2-methyl-2-piperidin-3-ylpropanamide |
|---|---|
| PubChem CID | 83199456 |
| Molecular Formula | C16H20ClN3O |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | N-(3-chloro-4-cyanophenyl)-2-methyl-2-piperidin-3-ylpropanamide |
| SMILES | CC(C)(C(=O)Nc1ccc(C#N)c(Cl)c1)C1CCCNC1 |
| InChI | InChI=1S/C16H20ClN3O/c1-16(2,12-4-3-7-19-10-12)15(21)20-13-6-5-11(9-18)14(17)8-13/h5-6,8,12,19H,3-4,7,10H2,1-2H3,(H,20,21) |
| InChIKey | WANDKAHBWPXDTC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |