C22H19ClN2O3 — CID 42642184
N-(3-chloro-4-cyanophenyl)-2-cyclopentyl-2-hydroxy-4-(4-hydroxyphenyl)but-3-ynamide (PubChem CID 42642184) has the molecular formula C22H19ClN2O3 and a molecular weight of 394.86 g/mol. Its IUPAC name is N-(3-chloro-4-cyanophenyl)-2-cyclopentyl-2-hydroxy-4-(4-hydroxyphenyl)but-3-ynamide.
| Compound Name | N-(3-chloro-4-cyanophenyl)-2-cyclopentyl-2-hydroxy-4-(4-hydroxyphenyl)but-3-ynamide |
|---|---|
| PubChem CID | 42642184 |
| Molecular Formula | C22H19ClN2O3 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | N-(3-chloro-4-cyanophenyl)-2-cyclopentyl-2-hydroxy-4-(4-hydroxyphenyl)but-3-ynamide |
| SMILES | N#Cc1ccc(NC(=O)C(O)(C#Cc2ccc(O)cc2)C2CCCC2)cc1Cl |
| InChI | InChI=1S/C22H19ClN2O3/c23-20-13-18(8-7-16(20)14-24)25-21(27)22(28,17-3-1-2-4-17)12-11-15-5-9-19(26)10-6-15/h5-10,13,17,26,28H,1-4H2,(H,25,27) |
| InChIKey | NEFGIEHCXCBUSA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|