C25H22F3N3O4 — CID 42641278
methyl 4-[4-[4-cyano-3-(trifluoromethyl)anilino]-3-hydroxy-4-oxo-3-piperidin-4-ylbut-1-ynyl]benzoate (PubChem CID 42641278) has the molecular formula C25H22F3N3O4 and a molecular weight of 485.46 g/mol. Its IUPAC name is methyl 4-[4-[4-cyano-3-(trifluoromethyl)anilino]-3-hydroxy-4-oxo-3-piperidin-4-ylbut-1-ynyl]benzoate.
| Compound Name | methyl 4-[4-[4-cyano-3-(trifluoromethyl)anilino]-3-hydroxy-4-oxo-3-piperidin-4-ylbut-1-ynyl]benzoate |
|---|---|
| PubChem CID | 42641278 |
| Molecular Formula | C25H22F3N3O4 |
| Molecular Weight | 485.46 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | methyl 4-[4-[4-cyano-3-(trifluoromethyl)anilino]-3-hydroxy-4-oxo-3-piperidin-4-ylbut-1-ynyl]benzoate |
| SMILES | COC(=O)c1ccc(C#CC(O)(C(=O)Nc2ccc(C#N)c(C(F)(F)F)c2)C2CCNCC2)cc1 |
| InChI | InChI=1S/C25H22F3N3O4/c1-35-22(32)17-4-2-16(3-5-17)8-11-24(34,19-9-12-30-13-10-19)23(33)31-20-7-6-18(15-29)21(14-20)25(26,27)28/h2-7,14,19,30,34H,9-10,12-13H2,1H3,(H,31,33) |
| InChIKey | OGEBLRPSOFWKHS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 111.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|