C23H20F3N3O3 — CID 42640836
N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-4-(4-hydroxyphenyl)-2-piperidin-4-ylbut-3-ynamide (PubChem CID 42640836) has the molecular formula C23H20F3N3O3 and a molecular weight of 443.43 g/mol. Its IUPAC name is N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-4-(4-hydroxyphenyl)-2-piperidin-4-ylbut-3-ynamide.
| Compound Name | N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-4-(4-hydroxyphenyl)-2-piperidin-4-ylbut-3-ynamide |
|---|---|
| PubChem CID | 42640836 |
| Molecular Formula | C23H20F3N3O3 |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-4-(4-hydroxyphenyl)-2-piperidin-4-ylbut-3-ynamide |
| SMILES | N#Cc1ccc(NC(=O)C(O)(C#Cc2ccc(O)cc2)C2CCNCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C23H20F3N3O3/c24-23(25,26)20-13-18(4-3-16(20)14-27)29-21(31)22(32,17-8-11-28-12-9-17)10-7-15-1-5-19(30)6-2-15/h1-6,13,17,28,30,32H,8-9,11-12H2,(H,29,31) |
| InChIKey | HMJYLINWJKBINX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 105.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|