C11H7F3N2O3 — CID 65484763
3-[4-cyano-3-(trifluoromethyl)anilino]-3-oxopropanoic acid (PubChem CID 65484763) has the molecular formula C11H7F3N2O3 and a molecular weight of 272.18 g/mol. Its IUPAC name is 3-[4-cyano-3-(trifluoromethyl)anilino]-3-oxopropanoic acid.
| Compound Name | 3-[4-cyano-3-(trifluoromethyl)anilino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 65484763 |
| Molecular Formula | C11H7F3N2O3 |
| Molecular Weight | 272.18 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 3-[4-cyano-3-(trifluoromethyl)anilino]-3-oxopropanoic acid |
| SMILES | N#Cc1ccc(NC(=O)CC(=O)O)cc1C(F)(F)F |
| InChI | InChI=1S/C11H7F3N2O3/c12-11(13,14)8-3-7(2-1-6(8)5-15)16-9(17)4-10(18)19/h1-3H,4H2,(H,16,17)(H,18,19) |
| InChIKey | PUMLKXHGGSDSPV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.18 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|