C13H12BrF3N2O — CID 107910213
5-bromo-N-[4-cyano-3-(trifluoromethyl)phenyl]pentanamide (PubChem CID 107910213) has the molecular formula C13H12BrF3N2O and a molecular weight of 349.15 g/mol. Its IUPAC name is 5-bromo-N-[4-cyano-3-(trifluoromethyl)phenyl]pentanamide.
| Compound Name | 5-bromo-N-[4-cyano-3-(trifluoromethyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 107910213 |
| Molecular Formula | C13H12BrF3N2O |
| Molecular Weight | 349.15 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | 5-bromo-N-[4-cyano-3-(trifluoromethyl)phenyl]pentanamide |
| SMILES | N#Cc1ccc(NC(=O)CCCCBr)cc1C(F)(F)F |
| InChI | InChI=1S/C13H12BrF3N2O/c14-6-2-1-3-12(20)19-10-5-4-9(8-18)11(7-10)13(15,16)17/h4-5,7H,1-3,6H2,(H,19,20) |
| InChIKey | LZZSILCUNAWPHK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.15 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|