C17H10F4N4O — CID 121259698
1-[4-cyano-3-(fluoromethyl)phenyl]-3-[4-cyano-3-(trifluoromethyl)phenyl]urea (PubChem CID 121259698) has the molecular formula C17H10F4N4O and a molecular weight of 362.29 g/mol. Its IUPAC name is 1-[4-cyano-3-(fluoromethyl)phenyl]-3-[4-cyano-3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-cyano-3-(fluoromethyl)phenyl]-3-[4-cyano-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 121259698 |
| Molecular Formula | C17H10F4N4O |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 1-[4-cyano-3-(fluoromethyl)phenyl]-3-[4-cyano-3-(trifluoromethyl)phenyl]urea |
| SMILES | N#Cc1ccc(NC(=O)Nc2ccc(C#N)c(C(F)(F)F)c2)cc1CF |
| InChI | InChI=1S/C17H10F4N4O/c18-7-12-5-13(3-1-10(12)8-22)24-16(26)25-14-4-2-11(9-23)15(6-14)17(19,20)21/h1-6H,7H2,(H2,24,25,26) |
| InChIKey | MTEWLNUTDFDUIP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |