C11H8ClF3N2O2 — CID 69121812
3-chloro-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxypropanamide (PubChem CID 69121812) has the molecular formula C11H8ClF3N2O2 and a molecular weight of 292.64 g/mol. Its IUPAC name is 3-chloro-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxypropanamide.
| Compound Name | 3-chloro-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 69121812 |
| Molecular Formula | C11H8ClF3N2O2 |
| Molecular Weight | 292.64 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 3-chloro-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxypropanamide |
| SMILES | N#Cc1ccc(NC(=O)C(O)CCl)cc1C(F)(F)F |
| InChI | InChI=1S/C11H8ClF3N2O2/c12-4-9(18)10(19)17-7-2-1-6(5-16)8(3-7)11(13,14)15/h1-3,9,18H,4H2,(H,17,19) |
| InChIKey | TXOPXQYXTJEUOZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.64 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|