C15H17BrF3N3O3 — CID 159924354
(2R)-3-bromo-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxypropanamide;2-methylpropanamide (PubChem CID 159924354) has the molecular formula C15H17BrF3N3O3 and a molecular weight of 424.22 g/mol. Its IUPAC name is (2R)-3-bromo-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxypropanamide;2-methylpropanamide.
| Compound Name | (2R)-3-bromo-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxypropanamide;2-methylpropanamide |
|---|---|
| PubChem CID | 159924354 |
| Molecular Formula | C15H17BrF3N3O3 |
| Molecular Weight | 424.22 g/mol |
| Exact Mass | 423.04 |
| IUPAC Name | (2R)-3-bromo-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxypropanamide;2-methylpropanamide |
| SMILES | CC(C)C(N)=O.N#Cc1ccc(NC(=O)[C@@H](O)CBr)cc1C(F)(F)F |
| InChI | InChI=1S/C11H8BrF3N2O2.C4H9NO/c12-4-9(18)10(19)17-7-2-1-6(5-16)8(3-7)11(13,14)15;1-3(2)4(5)6/h1-3,9,18H,4H2,(H,17,19);3H,1-2H3,(H2,5,6)/t9-;/m0./s1 |
| InChIKey | NYUVRTVJZLBUDG-FVGYRXGTSA-N |
| XLogP | 2.40 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.22 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|