C14H16F3N3O2 — CID 154749442
1-[4-cyano-3-(trifluoromethyl)phenyl]-3-(2-hydroxy-3-methylbutyl)urea (PubChem CID 154749442) has the molecular formula C14H16F3N3O2 and a molecular weight of 315.30 g/mol. Its IUPAC name is 1-[4-cyano-3-(trifluoromethyl)phenyl]-3-(2-hydroxy-3-methylbutyl)urea.
| Compound Name | 1-[4-cyano-3-(trifluoromethyl)phenyl]-3-(2-hydroxy-3-methylbutyl)urea |
|---|---|
| PubChem CID | 154749442 |
| Molecular Formula | C14H16F3N3O2 |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 1-[4-cyano-3-(trifluoromethyl)phenyl]-3-(2-hydroxy-3-methylbutyl)urea |
| SMILES | CC(C)C(O)CNC(=O)Nc1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H16F3N3O2/c1-8(2)12(21)7-19-13(22)20-10-4-3-9(6-18)11(5-10)14(15,16)17/h3-5,8,12,21H,7H2,1-2H3,(H2,19,20,22) |
| InChIKey | SSTVLWBMANIMPQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |