C21H19F3N4O2 — CID 166750218
3-(4-cyano-N-propylanilino)-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxypropanamide (PubChem CID 166750218) has the molecular formula C21H19F3N4O2 and a molecular weight of 416.40 g/mol. Its IUPAC name is 3-(4-cyano-N-propylanilino)-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxypropanamide.
| Compound Name | 3-(4-cyano-N-propylanilino)-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 166750218 |
| Molecular Formula | C21H19F3N4O2 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 3-(4-cyano-N-propylanilino)-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxypropanamide |
| SMILES | CCCN(CC(O)C(=O)Nc1ccc(C#N)c(C(F)(F)F)c1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C21H19F3N4O2/c1-2-9-28(17-7-3-14(11-25)4-8-17)13-19(29)20(30)27-16-6-5-15(12-26)18(10-16)21(22,23)24/h3-8,10,19,29H,2,9,13H2,1H3,(H,27,30) |
| InChIKey | RFGNBQBSMLXZSA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |