C21H22F3N3O — CID 11668233
2-[4-cyano-N-propyl-3-(trifluoromethyl)anilino]-N-[(1S)-1-phenylethyl]acetamide (PubChem CID 11668233) has the molecular formula C21H22F3N3O and a molecular weight of 389.42 g/mol. Its IUPAC name is 2-[4-cyano-N-propyl-3-(trifluoromethyl)anilino]-N-[(1S)-1-phenylethyl]acetamide.
| Compound Name | 2-[4-cyano-N-propyl-3-(trifluoromethyl)anilino]-N-[(1S)-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 11668233 |
| Molecular Formula | C21H22F3N3O |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 2-[4-cyano-N-propyl-3-(trifluoromethyl)anilino]-N-[(1S)-1-phenylethyl]acetamide |
| SMILES | CCCN(CC(=O)N[C@@H](C)c1ccccc1)c1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H22F3N3O/c1-3-11-27(14-20(28)26-15(2)16-7-5-4-6-8-16)18-10-9-17(13-25)19(12-18)21(22,23)24/h4-10,12,15H,3,11,14H2,1-2H3,(H,26,28)/t15-/m0/s1 |
| InChIKey | WPRLSRXINRMCQM-HNNXBMFYSA-N |
| XLogP | 4.67 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |