C12H13F3N2 — CID 11356913
4-(diethylamino)-2-(trifluoromethyl)benzonitrile (PubChem CID 11356913) has the molecular formula C12H13F3N2 and a molecular weight of 242.24 g/mol. Its IUPAC name is 4-(diethylamino)-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-(diethylamino)-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 11356913 |
| Molecular Formula | C12H13F3N2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 4-(diethylamino)-2-(trifluoromethyl)benzonitrile |
| SMILES | CCN(CC)c1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F3N2/c1-3-17(4-2)10-6-5-9(8-16)11(7-10)12(13,14)15/h5-7H,3-4H2,1-2H3 |
| InChIKey | RJJVBSQKXPHNMP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |