C16H21F3N2 — CID 11392366
4-(dibutylamino)-2-(trifluoromethyl)benzonitrile (PubChem CID 11392366) has the molecular formula C16H21F3N2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 4-(dibutylamino)-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-(dibutylamino)-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 11392366 |
| Molecular Formula | C16H21F3N2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 4-(dibutylamino)-2-(trifluoromethyl)benzonitrile |
| SMILES | CCCCN(CCCC)c1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H21F3N2/c1-3-5-9-21(10-6-4-2)14-8-7-13(12-20)15(11-14)16(17,18)19/h7-8,11H,3-6,9-10H2,1-2H3 |
| InChIKey | DROJJNYRJOQECY-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |