C14H15F3N2O2 — CID 62819452
2-[4-cyano-N-ethyl-3-(trifluoromethyl)anilino]-2-methylpropanoic acid (PubChem CID 62819452) has the molecular formula C14H15F3N2O2 and a molecular weight of 300.28 g/mol. Its IUPAC name is 2-[4-cyano-N-ethyl-3-(trifluoromethyl)anilino]-2-methylpropanoic acid.
| Compound Name | 2-[4-cyano-N-ethyl-3-(trifluoromethyl)anilino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 62819452 |
| Molecular Formula | C14H15F3N2O2 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-[4-cyano-N-ethyl-3-(trifluoromethyl)anilino]-2-methylpropanoic acid |
| SMILES | CCN(c1ccc(C#N)c(C(F)(F)F)c1)C(C)(C)C(=O)O |
| InChI | InChI=1S/C14H15F3N2O2/c1-4-19(13(2,3)12(20)21)10-6-5-9(8-18)11(7-10)14(15,16)17/h5-7H,4H2,1-3H3,(H,20,21) |
| InChIKey | MPBSTZGVIAGDRT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |