C9H4F3NO2 — CID 91882481
4-cyano-3-(trifluoromethyl)benzoic acid (PubChem CID 91882481) has the molecular formula C9H4F3NO2 and a molecular weight of 215.13 g/mol. Its IUPAC name is 4-cyano-3-(trifluoromethyl)benzoic acid.
| Compound Name | 4-cyano-3-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 91882481 |
| Molecular Formula | C9H4F3NO2 |
| Molecular Weight | 215.13 g/mol |
| Exact Mass | 215.02 |
| IUPAC Name | 4-cyano-3-(trifluoromethyl)benzoic acid |
| SMILES | N#Cc1ccc(C(=O)O)cc1C(F)(F)F |
| InChI | InChI=1S/C9H4F3NO2/c10-9(11,12)7-3-5(8(14)15)1-2-6(7)4-13/h1-3H,(H,14,15) |
| InChIKey | MLKHYEZBRDXLEK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.13 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |