C19H14F6O4 — CID 139971015
4-[2-[4-carboxy-2-(trifluoromethyl)phenyl]propan-2-yl]-3-(trifluoromethyl)benzoic acid (PubChem CID 139971015) has the molecular formula C19H14F6O4 and a molecular weight of 420.31 g/mol. Its IUPAC name is 4-[2-[4-carboxy-2-(trifluoromethyl)phenyl]propan-2-yl]-3-(trifluoromethyl)benzoic acid.
| Compound Name | 4-[2-[4-carboxy-2-(trifluoromethyl)phenyl]propan-2-yl]-3-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 139971015 |
| Molecular Formula | C19H14F6O4 |
| Molecular Weight | 420.31 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 4-[2-[4-carboxy-2-(trifluoromethyl)phenyl]propan-2-yl]-3-(trifluoromethyl)benzoic acid |
| SMILES | CC(C)(c1ccc(C(=O)O)cc1C(F)(F)F)c1ccc(C(=O)O)cc1C(F)(F)F |
| InChI | InChI=1S/C19H14F6O4/c1-17(2,11-5-3-9(15(26)27)7-13(11)18(20,21)22)12-6-4-10(16(28)29)8-14(12)19(23,24)25/h3-8H,1-2H3,(H,26,27)(H,28,29) |
| InChIKey | RSHOWQYVYQPLII-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.31 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |