C9H6ClF6NO — CID 174566583
3,4-bis(trifluoromethyl)benzamide;hydrochloride (PubChem CID 174566583) has the molecular formula C9H6ClF6NO and a molecular weight of 293.59 g/mol. Its IUPAC name is 3,4-bis(trifluoromethyl)benzamide;hydrochloride.
| Compound Name | 3,4-bis(trifluoromethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 174566583 |
| Molecular Formula | C9H6ClF6NO |
| Molecular Weight | 293.59 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | 3,4-bis(trifluoromethyl)benzamide;hydrochloride |
| SMILES | Cl.NC(=O)c1ccc(C(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H5F6NO.ClH/c10-8(11,12)5-2-1-4(7(16)17)3-6(5)9(13,14)15;/h1-3H,(H2,16,17);1H |
| InChIKey | ALBPWKXSWNPOMW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.59 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |