C10H7F6NO — CID 87509957
2-[3,4-bis(trifluoromethyl)phenyl]acetamide (PubChem CID 87509957) has the molecular formula C10H7F6NO and a molecular weight of 271.16 g/mol. Its IUPAC name is 2-[3,4-bis(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[3,4-bis(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 87509957 |
| Molecular Formula | C10H7F6NO |
| Molecular Weight | 271.16 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 2-[3,4-bis(trifluoromethyl)phenyl]acetamide |
| SMILES | NC(=O)Cc1ccc(C(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H7F6NO/c11-9(12,13)6-2-1-5(4-8(17)18)3-7(6)10(14,15)16/h1-3H,4H2,(H2,17,18) |
| InChIKey | TZGXCTGMLRZOLQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.16 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |