C10H9F4NO — CID 69353641
3-[3-fluoro-4-(trifluoromethyl)phenyl]propanamide (PubChem CID 69353641) has the molecular formula C10H9F4NO and a molecular weight of 235.18 g/mol. Its IUPAC name is 3-[3-fluoro-4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-[3-fluoro-4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 69353641 |
| Molecular Formula | C10H9F4NO |
| Molecular Weight | 235.18 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 3-[3-fluoro-4-(trifluoromethyl)phenyl]propanamide |
| SMILES | NC(=O)CCc1ccc(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C10H9F4NO/c11-8-5-6(2-4-9(15)16)1-3-7(8)10(12,13)14/h1,3,5H,2,4H2,(H2,15,16) |
| InChIKey | AQGOLHGMHJLKDT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.18 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |