C13H16F4O — CID 107290287
1-[3-fluoro-4-(trifluoromethyl)phenyl]-4-methylpentan-3-ol (PubChem CID 107290287) has the molecular formula C13H16F4O and a molecular weight of 264.26 g/mol. Its IUPAC name is 1-[3-fluoro-4-(trifluoromethyl)phenyl]-4-methylpentan-3-ol.
| Compound Name | 1-[3-fluoro-4-(trifluoromethyl)phenyl]-4-methylpentan-3-ol |
|---|---|
| PubChem CID | 107290287 |
| Molecular Formula | C13H16F4O |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 1-[3-fluoro-4-(trifluoromethyl)phenyl]-4-methylpentan-3-ol |
| SMILES | CC(C)C(O)CCc1ccc(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C13H16F4O/c1-8(2)12(18)6-4-9-3-5-10(11(14)7-9)13(15,16)17/h3,5,7-8,12,18H,4,6H2,1-2H3 |
| InChIKey | OLVCKQZKDDFSOE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |