C13H19FO — CID 64515839
1-(4-fluoro-3-methylphenyl)-4-methylpentan-3-ol (PubChem CID 64515839) has the molecular formula C13H19FO and a molecular weight of 210.29 g/mol. Its IUPAC name is 1-(4-fluoro-3-methylphenyl)-4-methylpentan-3-ol.
| Compound Name | 1-(4-fluoro-3-methylphenyl)-4-methylpentan-3-ol |
|---|---|
| PubChem CID | 64515839 |
| Molecular Formula | C13H19FO |
| Molecular Weight | 210.29 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 1-(4-fluoro-3-methylphenyl)-4-methylpentan-3-ol |
| SMILES | Cc1cc(CCC(O)C(C)C)ccc1F |
| InChI | InChI=1S/C13H19FO/c1-9(2)13(15)7-5-11-4-6-12(14)10(3)8-11/h4,6,8-9,13,15H,5,7H2,1-3H3 |
| InChIKey | MVLKJEJRSKNEAB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |