C11H15F2N — CID 90212776
(2S)-2-fluoro-4-(4-fluoro-3-methylphenyl)butan-1-amine (PubChem CID 90212776) has the molecular formula C11H15F2N and a molecular weight of 199.24 g/mol. Its IUPAC name is (2S)-2-fluoro-4-(4-fluoro-3-methylphenyl)butan-1-amine.
| Compound Name | (2S)-2-fluoro-4-(4-fluoro-3-methylphenyl)butan-1-amine |
|---|---|
| PubChem CID | 90212776 |
| Molecular Formula | C11H15F2N |
| Molecular Weight | 199.24 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | (2S)-2-fluoro-4-(4-fluoro-3-methylphenyl)butan-1-amine |
| SMILES | Cc1cc(CC[C@H](F)CN)ccc1F |
| InChI | InChI=1S/C11H15F2N/c1-8-6-9(3-5-11(8)13)2-4-10(12)7-14/h3,5-6,10H,2,4,7,14H2,1H3/t10-/m0/s1 |
| InChIKey | RBFWNSZXGNUHIR-JTQLQIEISA-N |
| XLogP | 2.36 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.24 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |