C10H15FN2 — CID 115226004
N'-[2-(4-fluoro-3-methylphenyl)ethyl]methanediamine (PubChem CID 115226004) has the molecular formula C10H15FN2 and a molecular weight of 182.24 g/mol. Its IUPAC name is N'-[2-(4-fluoro-3-methylphenyl)ethyl]methanediamine.
| Compound Name | N'-[2-(4-fluoro-3-methylphenyl)ethyl]methanediamine |
|---|---|
| PubChem CID | 115226004 |
| Molecular Formula | C10H15FN2 |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | N'-[2-(4-fluoro-3-methylphenyl)ethyl]methanediamine |
| SMILES | Cc1cc(CCNCN)ccc1F |
| InChI | InChI=1S/C10H15FN2/c1-8-6-9(2-3-10(8)11)4-5-13-7-12/h2-3,6,13H,4-5,7,12H2,1H3 |
| InChIKey | JIWLUUBMVQNVGV-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|