C11H14FNO2 — CID 115140036
N-[2-(4-fluoro-3-methylphenyl)ethyl]-2-hydroxyacetamide (PubChem CID 115140036) has the molecular formula C11H14FNO2 and a molecular weight of 211.24 g/mol. Its IUPAC name is N-[2-(4-fluoro-3-methylphenyl)ethyl]-2-hydroxyacetamide.
| Compound Name | N-[2-(4-fluoro-3-methylphenyl)ethyl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 115140036 |
| Molecular Formula | C11H14FNO2 |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | N-[2-(4-fluoro-3-methylphenyl)ethyl]-2-hydroxyacetamide |
| SMILES | Cc1cc(CCNC(=O)CO)ccc1F |
| InChI | InChI=1S/C11H14FNO2/c1-8-6-9(2-3-10(8)12)4-5-13-11(15)7-14/h2-3,6,14H,4-5,7H2,1H3,(H,13,15) |
| InChIKey | QDQDWKLNQWKITM-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |