C20H22F4N- — CID 158164902
(4-tert-butylphenyl)methyl-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]azanide (PubChem CID 158164902) has the molecular formula C20H22F4N- and a molecular weight of 352.40 g/mol. Its IUPAC name is (4-tert-butylphenyl)methyl-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]azanide.
| Compound Name | (4-tert-butylphenyl)methyl-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]azanide |
|---|---|
| PubChem CID | 158164902 |
| Molecular Formula | C20H22F4N- |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | (4-tert-butylphenyl)methyl-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]azanide |
| SMILES | CC(C)(C)c1ccc(C[N-]CCc2ccc(C(F)(F)F)c(F)c2)cc1 |
| InChI | InChI=1S/C20H22F4N/c1-19(2,3)16-7-4-15(5-8-16)13-25-11-10-14-6-9-17(18(21)12-14)20(22,23)24/h4-9,12H,10-11,13H2,1-3H3/q-1 |
| InChIKey | FWSKBEZVZOXFRP-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|