C16H23F4N — CID 107290764
N-tert-butyl-3-[3-fluoro-4-(trifluoromethyl)phenyl]-3-methylbutan-1-amine (PubChem CID 107290764) has the molecular formula C16H23F4N and a molecular weight of 305.36 g/mol. Its IUPAC name is N-tert-butyl-3-[3-fluoro-4-(trifluoromethyl)phenyl]-3-methylbutan-1-amine.
| Compound Name | N-tert-butyl-3-[3-fluoro-4-(trifluoromethyl)phenyl]-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 107290764 |
| Molecular Formula | C16H23F4N |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | N-tert-butyl-3-[3-fluoro-4-(trifluoromethyl)phenyl]-3-methylbutan-1-amine |
| SMILES | CC(C)(C)NCCC(C)(C)c1ccc(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C16H23F4N/c1-14(2,3)21-9-8-15(4,5)11-6-7-12(13(17)10-11)16(18,19)20/h6-7,10,21H,8-9H2,1-5H3 |
| InChIKey | QAOQPQSTVWORPA-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |