C15H22BrClFN — CID 106763830
3-(4-bromo-3-chloro-2-fluorophenyl)-N-tert-butyl-3-methylbutan-1-amine (PubChem CID 106763830) has the molecular formula C15H22BrClFN and a molecular weight of 350.70 g/mol. Its IUPAC name is 3-(4-bromo-3-chloro-2-fluorophenyl)-N-tert-butyl-3-methylbutan-1-amine.
| Compound Name | 3-(4-bromo-3-chloro-2-fluorophenyl)-N-tert-butyl-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 106763830 |
| Molecular Formula | C15H22BrClFN |
| Molecular Weight | 350.70 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 3-(4-bromo-3-chloro-2-fluorophenyl)-N-tert-butyl-3-methylbutan-1-amine |
| SMILES | CC(C)(C)NCCC(C)(C)c1ccc(Br)c(Cl)c1F |
| InChI | InChI=1S/C15H22BrClFN/c1-14(2,3)19-9-8-15(4,5)10-6-7-11(16)12(17)13(10)18/h6-7,19H,8-9H2,1-5H3 |
| InChIKey | IOWXWNTYEPPJOS-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.70 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|