C12H16BrClFNO — CID 106763745
1-(4-bromo-3-chloro-2-fluorophenyl)-2-(tert-butylamino)ethanol (PubChem CID 106763745) has the molecular formula C12H16BrClFNO and a molecular weight of 324.62 g/mol. Its IUPAC name is 1-(4-bromo-3-chloro-2-fluorophenyl)-2-(tert-butylamino)ethanol.
| Compound Name | 1-(4-bromo-3-chloro-2-fluorophenyl)-2-(tert-butylamino)ethanol |
|---|---|
| PubChem CID | 106763745 |
| Molecular Formula | C12H16BrClFNO |
| Molecular Weight | 324.62 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 1-(4-bromo-3-chloro-2-fluorophenyl)-2-(tert-butylamino)ethanol |
| SMILES | CC(C)(C)NCC(O)c1ccc(Br)c(Cl)c1F |
| InChI | InChI=1S/C12H16BrClFNO/c1-12(2,3)16-6-9(17)7-4-5-8(13)10(14)11(7)15/h4-5,9,16-17H,6H2,1-3H3 |
| InChIKey | OJPBJFUOWOOYBG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.62 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|