C12H19Cl2NO — CID 45357807
(1R)-2-(tert-butylamino)-1-(2-chlorophenyl)ethanol;hydrochloride (PubChem CID 45357807) has the molecular formula C12H19Cl2NO and a molecular weight of 264.20 g/mol. Its IUPAC name is (1R)-2-(tert-butylamino)-1-(2-chlorophenyl)ethanol;hydrochloride.
| Compound Name | (1R)-2-(tert-butylamino)-1-(2-chlorophenyl)ethanol;hydrochloride |
|---|---|
| PubChem CID | 45357807 |
| Molecular Formula | C12H19Cl2NO |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | (1R)-2-(tert-butylamino)-1-(2-chlorophenyl)ethanol;hydrochloride |
| SMILES | CC(C)(C)NC[C@H](O)c1ccccc1Cl.Cl |
| InChI | InChI=1S/C12H18ClNO.ClH/c1-12(2,3)14-8-11(15)9-6-4-5-7-10(9)13;/h4-7,11,14-15H,8H2,1-3H3;1H/t11-;/m0./s1 |
| InChIKey | RSLNRVYIRDVHLY-MERQFXBCSA-N |
| XLogP | 3.18 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |