C14H24ClNO2 — CID 174971213
2-(tert-butylamino)-1-(2-chlorophenyl)ethanol;ethanol (PubChem CID 174971213) has the molecular formula C14H24ClNO2 and a molecular weight of 273.80 g/mol. Its IUPAC name is 2-(tert-butylamino)-1-(2-chlorophenyl)ethanol;ethanol.
| Compound Name | 2-(tert-butylamino)-1-(2-chlorophenyl)ethanol;ethanol |
|---|---|
| PubChem CID | 174971213 |
| Molecular Formula | C14H24ClNO2 |
| Molecular Weight | 273.80 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 2-(tert-butylamino)-1-(2-chlorophenyl)ethanol;ethanol |
| SMILES | CC(C)(C)NCC(O)c1ccccc1Cl.CCO |
| InChI | InChI=1S/C12H18ClNO.C2H6O/c1-12(2,3)14-8-11(15)9-6-4-5-7-10(9)13;1-2-3/h4-7,11,14-15H,8H2,1-3H3;3H,2H2,1H3 |
| InChIKey | NKBAIVAZQLUXBU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.80 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |