C11H17Cl2NO — CID 76957004
(1S)-1-(2-chlorophenyl)-2-(propan-2-ylamino)ethanol;hydrochloride (PubChem CID 76957004) has the molecular formula C11H17Cl2NO and a molecular weight of 250.17 g/mol. Its IUPAC name is (1S)-1-(2-chlorophenyl)-2-(propan-2-ylamino)ethanol;hydrochloride.
| Compound Name | (1S)-1-(2-chlorophenyl)-2-(propan-2-ylamino)ethanol;hydrochloride |
|---|---|
| PubChem CID | 76957004 |
| Molecular Formula | C11H17Cl2NO |
| Molecular Weight | 250.17 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | (1S)-1-(2-chlorophenyl)-2-(propan-2-ylamino)ethanol;hydrochloride |
| SMILES | CC(C)NC[C@@H](O)c1ccccc1Cl.Cl |
| InChI | InChI=1S/C11H16ClNO.ClH/c1-8(2)13-7-11(14)9-5-3-4-6-10(9)12;/h3-6,8,11,13-14H,7H2,1-2H3;1H/t11-;/m1./s1 |
| InChIKey | CPCPUCRSKRHVAH-RFVHGSKJSA-N |
| XLogP | 2.79 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.17 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |