C11H10BrClF4O2 — CID 106762188
1-(4-bromo-3-chloro-2-fluorophenyl)-3-(2,2,2-trifluoroethoxy)propan-1-ol (PubChem CID 106762188) has the molecular formula C11H10BrClF4O2 and a molecular weight of 365.55 g/mol. Its IUPAC name is 1-(4-bromo-3-chloro-2-fluorophenyl)-3-(2,2,2-trifluoroethoxy)propan-1-ol.
| Compound Name | 1-(4-bromo-3-chloro-2-fluorophenyl)-3-(2,2,2-trifluoroethoxy)propan-1-ol |
|---|---|
| PubChem CID | 106762188 |
| Molecular Formula | C11H10BrClF4O2 |
| Molecular Weight | 365.55 g/mol |
| Exact Mass | 363.95 |
| IUPAC Name | 1-(4-bromo-3-chloro-2-fluorophenyl)-3-(2,2,2-trifluoroethoxy)propan-1-ol |
| SMILES | OC(CCOCC(F)(F)F)c1ccc(Br)c(Cl)c1F |
| InChI | InChI=1S/C11H10BrClF4O2/c12-7-2-1-6(10(14)9(7)13)8(18)3-4-19-5-11(15,16)17/h1-2,8,18H,3-5H2 |
| InChIKey | RRWQBJRBTXBMIU-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|