C9H9BrClFO3S — CID 106765069
1-(4-bromo-3-chloro-2-fluorophenyl)-2-methylsulfonylethanol (PubChem CID 106765069) has the molecular formula C9H9BrClFO3S and a molecular weight of 331.59 g/mol. Its IUPAC name is 1-(4-bromo-3-chloro-2-fluorophenyl)-2-methylsulfonylethanol.
| Compound Name | 1-(4-bromo-3-chloro-2-fluorophenyl)-2-methylsulfonylethanol |
|---|---|
| PubChem CID | 106765069 |
| Molecular Formula | C9H9BrClFO3S |
| Molecular Weight | 331.59 g/mol |
| Exact Mass | 329.91 |
| IUPAC Name | 1-(4-bromo-3-chloro-2-fluorophenyl)-2-methylsulfonylethanol |
| SMILES | CS(=O)(=O)CC(O)c1ccc(Br)c(Cl)c1F |
| InChI | InChI=1S/C9H9BrClFO3S/c1-16(14,15)4-7(13)5-2-3-6(10)8(11)9(5)12/h2-3,7,13H,4H2,1H3 |
| InChIKey | CMZRZYSWNDXYKM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.59 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|