C10H5BrClF7O — CID 106765023
1-(4-bromo-3-chloro-2-fluorophenyl)-3,3,3-trifluoro-2-(trifluoromethyl)propan-1-ol (PubChem CID 106765023) has the molecular formula C10H5BrClF7O and a molecular weight of 389.49 g/mol. Its IUPAC name is 1-(4-bromo-3-chloro-2-fluorophenyl)-3,3,3-trifluoro-2-(trifluoromethyl)propan-1-ol.
| Compound Name | 1-(4-bromo-3-chloro-2-fluorophenyl)-3,3,3-trifluoro-2-(trifluoromethyl)propan-1-ol |
|---|---|
| PubChem CID | 106765023 |
| Molecular Formula | C10H5BrClF7O |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 387.91 |
| IUPAC Name | 1-(4-bromo-3-chloro-2-fluorophenyl)-3,3,3-trifluoro-2-(trifluoromethyl)propan-1-ol |
| SMILES | OC(c1ccc(Br)c(Cl)c1F)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H5BrClF7O/c11-4-2-1-3(6(13)5(4)12)7(20)8(9(14,15)16)10(17,18)19/h1-2,7-8,20H |
| InChIKey | NHPJSAMVJPWTFD-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|